C14H19NO5S — CID 63683453
4-(2-bicyclo[2.2.1]heptanylmethylsulfamoyl)-5-methylfuran-2-carboxylic acid (PubChem CID 63683453) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylmethylsulfamoyl)-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylmethylsulfamoyl)-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63683453 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylmethylsulfamoyl)-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NCC1CC2CCC1C2 |
| InChI | InChI=1S/C14H19NO5S/c1-8-13(6-12(20-8)14(16)17)21(18,19)15-7-11-5-9-2-3-10(11)4-9/h6,9-11,15H,2-5,7H2,1H3,(H,16,17) |
| InChIKey | NDCYWJPRUCLOAB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |