C15H18N4S — CID 63683723
4-(2-bicyclo[2.2.1]heptanylmethyl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione (PubChem CID 63683723) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylmethyl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylmethyl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 63683723 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylmethyl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cccnc2)n1CC1CC2CCC1C2 |
| InChI | InChI=1S/C15H18N4S/c20-15-18-17-14(12-2-1-5-16-8-12)19(15)9-13-7-10-3-4-11(13)6-10/h1-2,5,8,10-11,13H,3-4,6-7,9H2,(H,18,20) |
| InChIKey | XHWMQCHOGHBATD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|