C17H24N2S — CID 63683981
2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]benzenecarbothioamide (PubChem CID 63683981) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63683981 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(Cc1ccccc1C(N)=S)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H24N2S/c1-19(11-15-9-12-6-7-13(15)8-12)10-14-4-2-3-5-16(14)17(18)20/h2-5,12-13,15H,6-11H2,1H3,(H2,18,20) |
| InChIKey | SIJPELQCHDLTSM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|