C39H54O4 — CID 6368501
9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid (PubChem CID 6368501) has the molecular formula C39H54O4 and a molecular weight of 586.86 g/mol. Its IUPAC name is 9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid.
| Compound Name | 9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
|---|---|
| PubChem CID | 6368501 |
| Molecular Formula | C39H54O4 |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 586.40 |
| IUPAC Name | 9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES | C=C(C)C1CCC2(C(=O)O)CCC3(C)C(CCC4C5(C)CCC(C(=O)/C=C/c6ccc(O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C39H54O4/c1-24(2)27-16-21-39(34(42)43)23-22-37(6)29(33(27)39)13-15-32-36(5)19-17-28(35(3,4)31(36)18-20-38(32,37)7)30(41)14-10-25-8-11-26(40)12-9-25/h8-12,14,27-29,31-33,40H,1,13,15-23H2,2-7H3,(H,42,43)/b14-10+ |
| InChIKey | REILSQVUDFCUDB-GXDHUFHOSA-N |
| XLogP | 9.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|