C10H18BF3N- — CID 63685558
[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl-trifluoroboranuide (PubChem CID 63685558) has the molecular formula C10H18BF3N- and a molecular weight of 220.07 g/mol. Its IUPAC name is [2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl-trifluoroboranuide.
| Compound Name | [2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63685558 |
| Molecular Formula | C10H18BF3N- |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl-trifluoroboranuide |
| SMILES | CN(CC1CC2CCC1C2)C[B-](F)(F)F |
| InChI | InChI=1S/C10H18BF3N/c1-15(7-11(12,13)14)6-10-5-8-2-3-9(10)4-8/h8-10H,2-7H2,1H3/q-1 |
| InChIKey | IYWKAEHXHNJTKR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|