C13H19NO3S — CID 63685601
2-propoxyethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylate (PubChem CID 63685601) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-propoxyethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylate.
| Compound Name | 2-propoxyethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 63685601 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-propoxyethyl 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylate |
| SMILES | CCCOCCOC(=O)C1NCCc2sccc21 |
| InChI | InChI=1S/C13H19NO3S/c1-2-6-16-7-8-17-13(15)12-10-4-9-18-11(10)3-5-14-12/h4,9,12,14H,2-3,5-8H2,1H3 |
| InChIKey | DCXRVINZLLBSGU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|