C12H15N3O3 — CID 63685700
N-(2,2-dimethoxyethyl)-3-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 63685700) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-(2,2-dimethoxyethyl)-3-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 63685700 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | COC(CNc1cccc(-c2nnco2)c1)OC |
| InChI | InChI=1S/C12H15N3O3/c1-16-11(17-2)7-13-10-5-3-4-9(6-10)12-15-14-8-18-12/h3-6,8,11,13H,7H2,1-2H3 |
| InChIKey | UMNCWSCLXKKWLH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|