About 2-propoxyethyl 4-ethylpiperidine-4-carboxylate
2-propoxyethyl 4-ethylpiperidine-4-carboxylate (PubChem CID 63686530) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-propoxyethyl 4-ethylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | 2-propoxyethyl 4-ethylpiperidine-4-carboxylate |
| PubChem CID | 63686530 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-propoxyethyl 4-ethylpiperidine-4-carboxylate |
| SMILES | CCCOCCOC(=O)C1(CC)CCNCC1 |
| InChI | InChI=1S/C13H25NO3/c1-3-9-16-10-11-17-12(15)13(4-2)5-7-14-8-6-13/h14H,3-11H2,1-2H3 |
| InChIKey | MONSOXMLULDNTQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxyethyl 4-ethylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxyethyl 4-ethylpiperidine-4-carboxylate?
The IUPAC name of 2-propoxyethyl 4-ethylpiperidine-4-carboxylate (CID 63686530) is 2-propoxyethyl 4-ethylpiperidine-4-carboxylate.
What is the SMILES notation for 2-propoxyethyl 4-ethylpiperidine-4-carboxylate?
The canonical SMILES for 2-propoxyethyl 4-ethylpiperidine-4-carboxylate is CCCOCCOC(=O)C1(CC)CCNCC1.
What is the InChIKey of 2-propoxyethyl 4-ethylpiperidine-4-carboxylate?
The InChIKey is MONSOXMLULDNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-3-9-16-10-11-17-12(15)13(4-2)5-7-14-8-6-13/h14H,3-11H2,1-2H3.
What are the key properties of 2-propoxyethyl 4-ethylpiperidine-4-carboxylate?
2-propoxyethyl 4-ethylpiperidine-4-carboxylate has a molecular weight of 243.35 g/mol, XLogP of 1.74, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxyethyl 4-ethylpiperidine-4-carboxylate is sourced from PubChem (CID 63686530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).