C14H19NO3S — CID 63687336
N-[3-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-2-methylpropane-2-sulfonamide (PubChem CID 63687336) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[3-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[3-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 63687336 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[3-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-2-methylpropane-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)C(C)(C)C)cc1C#CCO |
| InChI | InChI=1S/C14H19NO3S/c1-11-7-8-13(10-12(11)6-5-9-16)15-19(17,18)14(2,3)4/h7-8,10,15-16H,9H2,1-4H3 |
| InChIKey | XATUHBMLJJOIFD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|