C14H30N2O2S — CID 63688957
N-[1-(aminomethyl)cyclohexyl]-2-methyl-N-propylpropane-2-sulfonamide (PubChem CID 63688957) has the molecular formula C14H30N2O2S and a molecular weight of 290.47 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclohexyl]-2-methyl-N-propylpropane-2-sulfonamide.
| Compound Name | N-[1-(aminomethyl)cyclohexyl]-2-methyl-N-propylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 63688957 |
| Molecular Formula | C14H30N2O2S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-[1-(aminomethyl)cyclohexyl]-2-methyl-N-propylpropane-2-sulfonamide |
| SMILES | CCCN(C1(CN)CCCCC1)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O2S/c1-5-11-16(19(17,18)13(2,3)4)14(12-15)9-7-6-8-10-14/h5-12,15H2,1-4H3 |
| InChIKey | DPJDHFTVNACAPH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |