About 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid
2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid (PubChem CID 63690018) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid.
Molecular Properties
| Compound Name | 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid |
| PubChem CID | 63690018 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid |
| SMILES | CCCN(C=O)C(C(=O)O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H21NO3/c1-5-6-16(9-17)14(15(18)19)13-11(3)7-10(2)8-12(13)4/h7-9,14H,5-6H2,1-4H3,(H,18,19) |
| InChIKey | LCMYFKXWOHXGCL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid?
The IUPAC name of 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid (CID 63690018) is 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid.
What is the SMILES notation for 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid?
The canonical SMILES for 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid is CCCN(C=O)C(C(=O)O)c1c(C)cc(C)cc1C.
What is the InChIKey of 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid?
The InChIKey is LCMYFKXWOHXGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-5-6-16(9-17)14(15(18)19)13-11(3)7-10(2)8-12(13)4/h7-9,14H,5-6H2,1-4H3,(H,18,19).
What are the key properties of 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid?
2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid has a molecular weight of 263.34 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[formyl(propyl)amino]-2-(2,4,6-trimethylphenyl)acetic acid is sourced from PubChem (CID 63690018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).