C17H29ClN2O — CID 63690707
1-(4-chlorophenyl)-N'-(2-ethoxyethyl)-N,N'-diethylpropane-1,3-diamine (PubChem CID 63690707) has the molecular formula C17H29ClN2O and a molecular weight of 312.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-(2-ethoxyethyl)-N,N'-diethylpropane-1,3-diamine.
| Compound Name | 1-(4-chlorophenyl)-N'-(2-ethoxyethyl)-N,N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63690707 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-(2-ethoxyethyl)-N,N'-diethylpropane-1,3-diamine |
| SMILES | CCNC(CCN(CC)CCOCC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H29ClN2O/c1-4-19-17(15-7-9-16(18)10-8-15)11-12-20(5-2)13-14-21-6-3/h7-10,17,19H,4-6,11-14H2,1-3H3 |
| InChIKey | LBRZYIVFFNJQCZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|