C16H27FN2O2 — CID 63691377
N-(2-ethoxyethyl)-N-ethyl-2-fluoro-4-[(2-methoxyethylamino)methyl]aniline (PubChem CID 63691377) has the molecular formula C16H27FN2O2 and a molecular weight of 298.40 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-ethyl-2-fluoro-4-[(2-methoxyethylamino)methyl]aniline.
| Compound Name | N-(2-ethoxyethyl)-N-ethyl-2-fluoro-4-[(2-methoxyethylamino)methyl]aniline |
|---|---|
| PubChem CID | 63691377 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | N-(2-ethoxyethyl)-N-ethyl-2-fluoro-4-[(2-methoxyethylamino)methyl]aniline |
| SMILES | CCOCCN(CC)c1ccc(CNCCOC)cc1F |
| InChI | InChI=1S/C16H27FN2O2/c1-4-19(9-11-21-5-2)16-7-6-14(12-15(16)17)13-18-8-10-20-3/h6-7,12,18H,4-5,8-11,13H2,1-3H3 |
| InChIKey | DBHPBMKIXYZSQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|