C14H15NO3S — CID 63691519
4-(1,1-dioxothiolan-3-yl)oxynaphthalen-1-amine (PubChem CID 63691519) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)oxynaphthalen-1-amine.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)oxynaphthalen-1-amine |
|---|---|
| PubChem CID | 63691519 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)oxynaphthalen-1-amine |
| SMILES | Nc1ccc(OC2CCS(=O)(=O)C2)c2ccccc12 |
| InChI | InChI=1S/C14H15NO3S/c15-13-5-6-14(12-4-2-1-3-11(12)13)18-10-7-8-19(16,17)9-10/h1-6,10H,7-9,15H2 |
| InChIKey | JXXJGDPXJVRRCE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|