C15H24N4O — CID 63691729
N-(2-ethoxyethyl)-N-ethyl-3-(methylaminomethyl)imidazo[1,2-a]pyridin-2-amine (PubChem CID 63691729) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-ethyl-3-(methylaminomethyl)imidazo[1,2-a]pyridin-2-amine.
| Compound Name | N-(2-ethoxyethyl)-N-ethyl-3-(methylaminomethyl)imidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 63691729 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-(2-ethoxyethyl)-N-ethyl-3-(methylaminomethyl)imidazo[1,2-a]pyridin-2-amine |
| SMILES | CCOCCN(CC)c1nc2ccccn2c1CNC |
| InChI | InChI=1S/C15H24N4O/c1-4-18(10-11-20-5-2)15-13(12-16-3)19-9-7-6-8-14(19)17-15/h6-9,16H,4-5,10-12H2,1-3H3 |
| InChIKey | QMAMWOJWPAXZIA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|