About (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium)
(2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) (PubChem CID 6369264) has the molecular formula C12H37IrNO3P3+6
and a molecular weight of 528.57 g/mol. Its IUPAC name is (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium).
Molecular Properties
| Compound Name | (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) |
| PubChem CID | 6369264 |
| Molecular Formula | C12H37IrNO3P3+6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) |
| SMILES | C[PH+](C)C.C[PH+](C)C.C[PH+](C)C.[Ir+3].[NH-]C(CO)C(=O)[OH2+] |
| InChI | InChI=1S/C3H6NO3.3C3H9P.Ir/c4-2(1-5)3(6)7;3*1-4(2)3;/h2,4-5H,1H2,(H,6,7);3*1-3H3;/q-1;;;;+3/p+4 |
| InChIKey | OWDCAOLTJRMASF-UHFFFAOYSA-R |
| XLogP | 1.92 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium)?
The IUPAC name of (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) (CID 6369264) is (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium).
What is the SMILES notation for (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium)?
The canonical SMILES for (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) is C[PH+](C)C.C[PH+](C)C.C[PH+](C)C.[Ir+3].[NH-]C(CO)C(=O)[OH2+].
What is the InChIKey of (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium)?
The InChIKey is OWDCAOLTJRMASF-UHFFFAOYSA-R. The full InChI is InChI=1S/C3H6NO3.3C3H9P.Ir/c4-2(1-5)3(6)7;3*1-4(2)3;/h2,4-5H,1H2,(H,6,7);3*1-3H3;/q-1;;;;+3/p+4.
What are the key properties of (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium)?
(2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) has a molecular weight of 528.57 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-1-oxoniocarbonylethyl)azanide;iridium(3+);tris(trimethylphosphanium) is sourced from PubChem (CID 6369264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).