About 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide
2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide (PubChem CID 63693134) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide |
| PubChem CID | 63693134 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide |
| SMILES | CC(C)C(N)C(=O)N(C)CCCN(C)C |
| InChI | InChI=1S/C11H25N3O/c1-9(2)10(12)11(15)14(5)8-6-7-13(3)4/h9-10H,6-8,12H2,1-5H3 |
| InChIKey | GYDXSHKYUVEUCC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide?
The IUPAC name of 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide (CID 63693134) is 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide.
What is the SMILES notation for 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide?
The canonical SMILES for 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide is CC(C)C(N)C(=O)N(C)CCCN(C)C.
What is the InChIKey of 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide?
The InChIKey is GYDXSHKYUVEUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O/c1-9(2)10(12)11(15)14(5)8-6-7-13(3)4/h9-10H,6-8,12H2,1-5H3.
What are the key properties of 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide?
2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide has a molecular weight of 215.34 g/mol, XLogP of 0.38, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[3-(dimethylamino)propyl]-N,3-dimethylbutanamide is sourced from PubChem (CID 63693134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).