C16H17N3S — CID 63694923
2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-benzimidazol-4-amine (PubChem CID 63694923) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-benzimidazol-4-amine.
| Compound Name | 2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-benzimidazol-4-amine |
|---|---|
| PubChem CID | 63694923 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-1H-benzimidazol-4-amine |
| SMILES | Nc1cccc2[nH]c(-c3cc4c(s3)CCCCC4)nc12 |
| InChI | InChI=1S/C16H17N3S/c17-11-6-4-7-12-15(11)19-16(18-12)14-9-10-5-2-1-3-8-13(10)20-14/h4,6-7,9H,1-3,5,8,17H2,(H,18,19) |
| InChIKey | JLUNCMNPYMDIPW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|