C10H14N4OS — CID 63696968
2-(cyclopropylamino)-3-pyrimidin-4-ylsulfanylpropanamide (PubChem CID 63696968) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 2-(cyclopropylamino)-3-pyrimidin-4-ylsulfanylpropanamide.
| Compound Name | 2-(cyclopropylamino)-3-pyrimidin-4-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 63696968 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(cyclopropylamino)-3-pyrimidin-4-ylsulfanylpropanamide |
| SMILES | NC(=O)C(CSc1ccncn1)NC1CC1 |
| InChI | InChI=1S/C10H14N4OS/c11-10(15)8(14-7-1-2-7)5-16-9-3-4-12-6-13-9/h3-4,6-8,14H,1-2,5H2,(H2,11,15) |
| InChIKey | LZWVSLAMCFVBMU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |