C26H30N4O2 — CID 6369714
N,N'-bis[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]hexanediamide (PubChem CID 6369714) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N,N'-bis[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]hexanediamide.
| Compound Name | N,N'-bis[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]hexanediamide |
|---|---|
| PubChem CID | 6369714 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N,N'-bis[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]hexanediamide |
| SMILES | CC(/C=N\NC(=O)CCCCC(=O)N/N=C\C(C)=C\c1ccccc1)=C\c1ccccc1 |
| InChI | InChI=1S/C26H30N4O2/c1-21(17-23-11-5-3-6-12-23)19-27-29-25(31)15-9-10-16-26(32)30-28-20-22(2)18-24-13-7-4-8-14-24/h3-8,11-14,17-20H,9-10,15-16H2,1-2H3,(H,29,31)(H,30,32)/b21-17+,22-18+,27-19-,28-20- |
| InChIKey | RTQBUBOGZYYOFB-QXNQCOBNSA-N |
| XLogP | 4.96 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|