About N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide
N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide (PubChem CID 6369738) has the molecular formula C23H29N3O2
and a molecular weight of 379.50 g/mol. Its IUPAC name is N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide.
Molecular Properties
| Compound Name | N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide |
| PubChem CID | 6369738 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide |
| SMILES | CCCCC/C(=N\NC(=O)CCC(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2/c1-2-3-6-15-21(20-13-9-5-10-14-20)25-26-23(28)17-16-22(27)24-18-19-11-7-4-8-12-19/h4-5,7-14H,2-3,6,15-18H2,1H3,(H,24,27)(H,26,28)/b25-21+ |
| InChIKey | HDSSVBDHPBLCQI-NJNXFGOHSA-N |
| XLogP | 4.18 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide?
The IUPAC name of N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide (CID 6369738) is N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide.
What is the SMILES notation for N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide?
The canonical SMILES for N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide is CCCCC/C(=N\NC(=O)CCC(=O)NCc1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide?
The InChIKey is HDSSVBDHPBLCQI-NJNXFGOHSA-N. The full InChI is InChI=1S/C23H29N3O2/c1-2-3-6-15-21(20-13-9-5-10-14-20)25-26-23(28)17-16-22(27)24-18-19-11-7-4-8-12-19/h4-5,7-14H,2-3,6,15-18H2,1H3,(H,24,27)(H,26,28)/b25-21+.
What are the key properties of N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide?
N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide has a molecular weight of 379.50 g/mol, XLogP of 4.18, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-[(E)-1-phenylhexylideneamino]butanediamide is sourced from PubChem (CID 6369738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).