About N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline
N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline (PubChem CID 63697413) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline |
| PubChem CID | 63697413 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline |
| SMILES | COC(CNc1ccc(C(C)C)cc1C(C)C)OC |
| InChI | InChI=1S/C16H27NO2/c1-11(2)13-7-8-15(14(9-13)12(3)4)17-10-16(18-5)19-6/h7-9,11-12,16-17H,10H2,1-6H3 |
| InChIKey | NAFXVUGPZCQSMO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline?
The IUPAC name of N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline (CID 63697413) is N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline.
What is the SMILES notation for N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline?
The canonical SMILES for N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline is COC(CNc1ccc(C(C)C)cc1C(C)C)OC.
What is the InChIKey of N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline?
The InChIKey is NAFXVUGPZCQSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2/c1-11(2)13-7-8-15(14(9-13)12(3)4)17-10-16(18-5)19-6/h7-9,11-12,16-17H,10H2,1-6H3.
What are the key properties of N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline?
N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline has a molecular weight of 265.40 g/mol, XLogP of 3.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethoxyethyl)-2,4-di(propan-2-yl)aniline is sourced from PubChem (CID 63697413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).