C11H19N3O5S — CID 63698100
2-[4-[2-ethoxyethyl(ethyl)sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 63698100) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[4-[2-ethoxyethyl(ethyl)sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[2-ethoxyethyl(ethyl)sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 63698100 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[4-[2-ethoxyethyl(ethyl)sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | CCOCCN(CC)S(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C11H19N3O5S/c1-3-14(5-6-19-4-2)20(17,18)10-7-12-13(8-10)9-11(15)16/h7-8H,3-6,9H2,1-2H3,(H,15,16) |
| InChIKey | VBNQPRPXOCTCBV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|