C14H19F2NO2 — CID 63698278
1-(2,6-difluorophenyl)-2-[2-ethoxyethyl(ethyl)amino]ethanone (PubChem CID 63698278) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[2-ethoxyethyl(ethyl)amino]ethanone.
| Compound Name | 1-(2,6-difluorophenyl)-2-[2-ethoxyethyl(ethyl)amino]ethanone |
|---|---|
| PubChem CID | 63698278 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[2-ethoxyethyl(ethyl)amino]ethanone |
| SMILES | CCOCCN(CC)CC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO2/c1-3-17(8-9-19-4-2)10-13(18)14-11(15)6-5-7-12(14)16/h5-7H,3-4,8-10H2,1-2H3 |
| InChIKey | XOHXWPHTVLUTMA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|