C12H17ClF2N2 — CID 63699002
N'-[4-(chloromethyl)-2,6-difluorophenyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 63699002) has the molecular formula C12H17ClF2N2 and a molecular weight of 262.73 g/mol. Its IUPAC name is N'-[4-(chloromethyl)-2,6-difluorophenyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[4-(chloromethyl)-2,6-difluorophenyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63699002 |
| Molecular Formula | C12H17ClF2N2 |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N'-[4-(chloromethyl)-2,6-difluorophenyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C12H17ClF2N2/c1-16(2)4-5-17(3)12-10(14)6-9(8-13)7-11(12)15/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | IXPLNVOEDFZBRF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|