C13H26N4 — CID 63700305
2-(cyclopropylamino)-3-[3-(dimethylamino)propyl-methylamino]-2-methylpropanenitrile (PubChem CID 63700305) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-(cyclopropylamino)-3-[3-(dimethylamino)propyl-methylamino]-2-methylpropanenitrile.
| Compound Name | 2-(cyclopropylamino)-3-[3-(dimethylamino)propyl-methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 63700305 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | 2-(cyclopropylamino)-3-[3-(dimethylamino)propyl-methylamino]-2-methylpropanenitrile |
| SMILES | CN(C)CCCN(C)CC(C)(C#N)NC1CC1 |
| InChI | InChI=1S/C13H26N4/c1-13(10-14,15-12-6-7-12)11-17(4)9-5-8-16(2)3/h12,15H,5-9,11H2,1-4H3 |
| InChIKey | CBWUTEDVNZIHAJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |