C11H18N2O3 — CID 63700572
5-[3-(dimethylamino)propyl-methylamino]furan-2-carboxylic acid (PubChem CID 63700572) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl-methylamino]furan-2-carboxylic acid.
| Compound Name | 5-[3-(dimethylamino)propyl-methylamino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63700572 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-[3-(dimethylamino)propyl-methylamino]furan-2-carboxylic acid |
| SMILES | CN(C)CCCN(C)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H18N2O3/c1-12(2)7-4-8-13(3)10-6-5-9(16-10)11(14)15/h5-6H,4,7-8H2,1-3H3,(H,14,15) |
| InChIKey | GFBHCKWMTLRZCG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |