C11H17BrClN3 — CID 63700610
N'-[5-bromo-3-(chloromethyl)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 63700610) has the molecular formula C11H17BrClN3 and a molecular weight of 306.64 g/mol. Its IUPAC name is N'-[5-bromo-3-(chloromethyl)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[5-bromo-3-(chloromethyl)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63700610 |
| Molecular Formula | C11H17BrClN3 |
| Molecular Weight | 306.64 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N'-[5-bromo-3-(chloromethyl)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1ncc(Br)cc1CCl |
| InChI | InChI=1S/C11H17BrClN3/c1-15(2)4-5-16(3)11-9(7-13)6-10(12)8-14-11/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | VLDXAHDGPPNKPG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|