C13H24N8 — CID 63700678
N'-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 63700678) has the molecular formula C13H24N8 and a molecular weight of 292.39 g/mol. Its IUPAC name is N'-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63700678 |
| Molecular Formula | C13H24N8 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | N'-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)Cc1nc(NN)c2cnn(C)c2n1 |
| InChI | InChI=1S/C13H24N8/c1-19(2)6-5-7-20(3)9-11-16-12(18-14)10-8-15-21(4)13(10)17-11/h8H,5-7,9,14H2,1-4H3,(H,16,17,18) |
| InChIKey | GWDAHHKHOJIZDM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|