C7H9BF3N2O- — CID 63701510
(4,6-dimethyl-2-oxopyrimidin-1-yl)methyl-trifluoroboranuide (PubChem CID 63701510) has the molecular formula C7H9BF3N2O- and a molecular weight of 204.97 g/mol. Its IUPAC name is (4,6-dimethyl-2-oxopyrimidin-1-yl)methyl-trifluoroboranuide.
| Compound Name | (4,6-dimethyl-2-oxopyrimidin-1-yl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63701510 |
| Molecular Formula | C7H9BF3N2O- |
| Molecular Weight | 204.97 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (4,6-dimethyl-2-oxopyrimidin-1-yl)methyl-trifluoroboranuide |
| SMILES | Cc1cc(C)n(C[B-](F)(F)F)c(=O)n1 |
| InChI | InChI=1S/C7H9BF3N2O/c1-5-3-6(2)13(7(14)12-5)4-8(9,10)11/h3H,4H2,1-2H3/q-1 |
| InChIKey | VYMZXOISXSJYHO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.97 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|