About potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide
potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide (PubChem CID 63701781) has the molecular formula C7H11BF3KN2O2
and a molecular weight of 262.08 g/mol. Its IUPAC name is potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide.
Molecular Properties
| Compound Name | potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide |
| PubChem CID | 63701781 |
| Molecular Formula | C7H11BF3KN2O2 |
| Molecular Weight | 262.08 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide |
| SMILES | CCN1CCN(C[B-](F)(F)F)C(=O)C1=O.[K+] |
| InChI | InChI=1S/C7H11BF3N2O2.K/c1-2-12-3-4-13(5-8(9,10)11)7(15)6(12)14;/h2-5H2,1H3;/q-1;+1 |
| InChIKey | WWZWTZSDDWLSMA-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.08 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide?
The IUPAC name of potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide (CID 63701781) is potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide.
What is the SMILES notation for potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide?
The canonical SMILES for potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide is CCN1CCN(C[B-](F)(F)F)C(=O)C1=O.[K+].
What is the InChIKey of potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide?
The InChIKey is WWZWTZSDDWLSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BF3N2O2.K/c1-2-12-3-4-13(5-8(9,10)11)7(15)6(12)14;/h2-5H2,1H3;/q-1;+1.
What are the key properties of potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide?
potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide has a molecular weight of 262.08 g/mol, XLogP of -2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (4-ethyl-2,3-dioxopiperazin-1-yl)methyl-trifluoroboranuide is sourced from PubChem (CID 63701781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).