C20H28O4 — CID 637018
(1S,2R,3S,7R,8R,11S,12R,14Z,17S)-12-hydroxy-4,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadeca-4,14-dien-6-one (PubChem CID 637018) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,2R,3S,7R,8R,11S,12R,14Z,17S)-12-hydroxy-4,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadeca-4,14-dien-6-one.
| Compound Name | (1S,2R,3S,7R,8R,11S,12R,14Z,17S)-12-hydroxy-4,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadeca-4,14-dien-6-one |
|---|---|
| PubChem CID | 637018 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,2R,3S,7R,8R,11S,12R,14Z,17S)-12-hydroxy-4,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadeca-4,14-dien-6-one |
| SMILES | CC1=CC(=O)[C@H]2[C@H]3[C@@H]1[C@@H]1C/C(C)=C\C[C@@H](O)[C@](C)(OC[C@@H]2C)[C@H]3O1 |
| InChI | InChI=1S/C20H28O4/c1-10-5-6-15(22)20(4)19-18-16(12(3)9-23-20)13(21)8-11(2)17(18)14(7-10)24-19/h5,8,12,14-19,22H,6-7,9H2,1-4H3/b10-5-/t12-,14-,15+,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | MZJQEVBIFVOTEZ-HEWGSXFMSA-N |
| XLogP | 2.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|