About trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide
trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide (PubChem CID 63702033) has the molecular formula C5H10BF3NOS-
and a molecular weight of 200.01 g/mol. Its IUPAC name is trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide.
Molecular Properties
| Compound Name | trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide |
| PubChem CID | 63702033 |
| Molecular Formula | C5H10BF3NOS- |
| Molecular Weight | 200.01 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide |
| SMILES | O=S1CCN(C[B-](F)(F)F)CC1 |
| InChI | InChI=1S/C5H10BF3NOS/c7-6(8,9)5-10-1-3-12(11)4-2-10/h1-5H2/q-1 |
| InChIKey | XVPNMBLTCHMOAV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.01 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide?
The IUPAC name of trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide (CID 63702033) is trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide.
What is the SMILES notation for trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide?
The canonical SMILES for trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide is O=S1CCN(C[B-](F)(F)F)CC1.
What is the InChIKey of trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide?
The InChIKey is XVPNMBLTCHMOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BF3NOS/c7-6(8,9)5-10-1-3-12(11)4-2-10/h1-5H2/q-1.
What are the key properties of trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide?
trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide has a molecular weight of 200.01 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoro-[(1-oxo-1,4-thiazinan-4-yl)methyl]boranuide is sourced from PubChem (CID 63702033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).