About trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide
trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide (PubChem CID 63702802) has the molecular formula C6H11BF3N2O-
and a molecular weight of 194.97 g/mol. Its IUPAC name is trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide.
Molecular Properties
| Compound Name | trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide |
| PubChem CID | 63702802 |
| Molecular Formula | C6H11BF3N2O- |
| Molecular Weight | 194.97 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide |
| SMILES | O=C1CCN(C[B-](F)(F)F)CCN1 |
| InChI | InChI=1S/C6H11BF3N2O/c8-7(9,10)5-12-3-1-6(13)11-2-4-12/h1-5H2,(H,11,13)/q-1 |
| InChIKey | MBRDPOCNDCWPJI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.97 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide?
The IUPAC name of trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide (CID 63702802) is trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide.
What is the SMILES notation for trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide?
The canonical SMILES for trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide is O=C1CCN(C[B-](F)(F)F)CCN1.
What is the InChIKey of trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide?
The InChIKey is MBRDPOCNDCWPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BF3N2O/c8-7(9,10)5-12-3-1-6(13)11-2-4-12/h1-5H2,(H,11,13)/q-1.
What are the key properties of trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide?
trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide has a molecular weight of 194.97 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoro-[(5-oxo-1,4-diazepan-1-yl)methyl]boranuide is sourced from PubChem (CID 63702802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).