About [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide
[2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide (PubChem CID 63702814) has the molecular formula C7H16BF3N-
and a molecular weight of 182.02 g/mol. Its IUPAC name is [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide.
Molecular Properties
| Compound Name | [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide |
| PubChem CID | 63702814 |
| Molecular Formula | C7H16BF3N- |
| Molecular Weight | 182.02 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide |
| SMILES | CN(C[B-](F)(F)F)CC(C)(C)C |
| InChI | InChI=1S/C7H16BF3N/c1-7(2,3)5-12(4)6-8(9,10)11/h5-6H2,1-4H3/q-1 |
| InChIKey | OEMDAIBGDGQNJI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.02 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide?
The IUPAC name of [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide (CID 63702814) is [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide.
What is the SMILES notation for [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide?
The canonical SMILES for [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide is CN(C[B-](F)(F)F)CC(C)(C)C.
What is the InChIKey of [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide?
The InChIKey is OEMDAIBGDGQNJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16BF3N/c1-7(2,3)5-12(4)6-8(9,10)11/h5-6H2,1-4H3/q-1.
What are the key properties of [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide?
[2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide has a molecular weight of 182.02 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethylpropyl(methyl)amino]methyl-trifluoroboranuide is sourced from PubChem (CID 63702814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).