About 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol
4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol (PubChem CID 63702920) has the molecular formula C6H10N4OS
and a molecular weight of 186.24 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol |
| PubChem CID | 63702920 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol |
| SMILES | OC1CNCC1Sc1ncn[nH]1 |
| InChI | InChI=1S/C6H10N4OS/c11-4-1-7-2-5(4)12-6-8-3-9-10-6/h3-5,7,11H,1-2H2,(H,8,9,10) |
| InChIKey | AGHLONBTGVJYOV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol?
The IUPAC name of 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol (CID 63702920) is 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol.
What is the SMILES notation for 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol?
The canonical SMILES for 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol is OC1CNCC1Sc1ncn[nH]1.
What is the InChIKey of 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol?
The InChIKey is AGHLONBTGVJYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4OS/c11-4-1-7-2-5(4)12-6-8-3-9-10-6/h3-5,7,11H,1-2H2,(H,8,9,10).
What are the key properties of 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol?
4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol has a molecular weight of 186.24 g/mol, XLogP of -0.77, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidin-3-ol is sourced from PubChem (CID 63702920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).