About potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide
potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide (PubChem CID 63703626) has the molecular formula C4H4BF3KNOS
and a molecular weight of 221.05 g/mol. Its IUPAC name is potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide.
Molecular Properties
| Compound Name | potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide |
| PubChem CID | 63703626 |
| Molecular Formula | C4H4BF3KNOS |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 220.97 |
| IUPAC Name | potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide |
| SMILES | O=c1sccn1C[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C4H4BF3NOS.K/c6-5(7,8)3-9-1-2-11-4(9)10;/h1-2H,3H2;/q-1;+1 |
| InChIKey | ZXUVSUGLHDUARX-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide?
The IUPAC name of potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide (CID 63703626) is potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide.
What is the SMILES notation for potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide?
The canonical SMILES for potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide is O=c1sccn1C[B-](F)(F)F.[K+].
What is the InChIKey of potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide?
The InChIKey is ZXUVSUGLHDUARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BF3NOS.K/c6-5(7,8)3-9-1-2-11-4(9)10;/h1-2H,3H2;/q-1;+1.
What are the key properties of potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide?
potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide has a molecular weight of 221.05 g/mol, XLogP of -1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro-[(2-oxo-1,3-thiazol-3-yl)methyl]boranuide is sourced from PubChem (CID 63703626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).