About 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one
5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one (PubChem CID 637048) has the molecular formula C17H14O5
and a molecular weight of 298.29 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one.
Molecular Properties
| Compound Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one |
| PubChem CID | 637048 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one |
| SMILES | Cc1c(O)c(C)c2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C17H14O5/c1-8-14(19)9(2)17-13(15(8)20)16(21)12(7-22-17)10-3-5-11(18)6-4-10/h3-7,18-20H,1-2H3 |
| InChIKey | VSEIMGCATUFLSE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one?
The IUPAC name of 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one (CID 637048) is 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one.
What is the SMILES notation for 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one?
The canonical SMILES for 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one is Cc1c(O)c(C)c2occ(-c3ccc(O)cc3)c(=O)c2c1O.
What is the InChIKey of 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one?
The InChIKey is VSEIMGCATUFLSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O5/c1-8-14(19)9(2)17-13(15(8)20)16(21)12(7-22-17)10-3-5-11(18)6-4-10/h3-7,18-20H,1-2H3.
What are the key properties of 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one?
5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one has a molecular weight of 298.29 g/mol, XLogP of 3.19, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one is sourced from PubChem (CID 637048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).