C18H28N2O — CID 63706317
N-[[3-[[methyl(oxan-4-ylmethyl)amino]methyl]phenyl]methyl]cyclopropanamine (PubChem CID 63706317) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is N-[[3-[[methyl(oxan-4-ylmethyl)amino]methyl]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-[[methyl(oxan-4-ylmethyl)amino]methyl]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63706317 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[[3-[[methyl(oxan-4-ylmethyl)amino]methyl]phenyl]methyl]cyclopropanamine |
| SMILES | CN(Cc1cccc(CNC2CC2)c1)CC1CCOCC1 |
| InChI | InChI=1S/C18H28N2O/c1-20(13-15-7-9-21-10-8-15)14-17-4-2-3-16(11-17)12-19-18-5-6-18/h2-4,11,15,18-19H,5-10,12-14H2,1H3 |
| InChIKey | HBGXARBAJLVRGS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |