C12H17N3OS — CID 63707205
2-(oxan-4-ylmethylamino)pyridine-4-carbothioamide (PubChem CID 63707205) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(oxan-4-ylmethylamino)pyridine-4-carbothioamide.
| Compound Name | 2-(oxan-4-ylmethylamino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 63707205 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(oxan-4-ylmethylamino)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(NCC2CCOCC2)c1 |
| InChI | InChI=1S/C12H17N3OS/c13-12(17)10-1-4-14-11(7-10)15-8-9-2-5-16-6-3-9/h1,4,7,9H,2-3,5-6,8H2,(H2,13,17)(H,14,15) |
| InChIKey | VYPCABFJBYGVFP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|