C11H16F3N3O2 — CID 63708363
3-(propoxymethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole (PubChem CID 63708363) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-(propoxymethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(propoxymethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63708363 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-(propoxymethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CCCOCc1noc(C2(C(F)(F)F)CCNC2)n1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-2-5-18-6-8-16-9(19-17-8)10(11(12,13)14)3-4-15-7-10/h15H,2-7H2,1H3 |
| InChIKey | CMIQHTDNFMTOJN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|