C10H14F3NO2 — CID 63708383
1-but-3-en-2-yl-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63708383) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 1-but-3-en-2-yl-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-but-3-en-2-yl-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63708383 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-but-3-en-2-yl-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=CC(C)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3NO2/c1-3-7(2)14-5-4-9(6-14,8(15)16)10(11,12)13/h3,7H,1,4-6H2,2H3,(H,15,16) |
| InChIKey | UMDAFKKKGDMJKE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|