C23H23N5O7S — CID 6370942
methyl (5E)-5-[(3Z)-4-benzamido-3-[(3,5-dinitrophenyl)hydrazinylidene]thiolan-2-ylidene]pentanoate (PubChem CID 6370942) has the molecular formula C23H23N5O7S and a molecular weight of 513.53 g/mol. Its IUPAC name is methyl (5E)-5-[(3Z)-4-benzamido-3-[(3,5-dinitrophenyl)hydrazinylidene]thiolan-2-ylidene]pentanoate.
| Compound Name | methyl (5E)-5-[(3Z)-4-benzamido-3-[(3,5-dinitrophenyl)hydrazinylidene]thiolan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 6370942 |
| Molecular Formula | C23H23N5O7S |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | methyl (5E)-5-[(3Z)-4-benzamido-3-[(3,5-dinitrophenyl)hydrazinylidene]thiolan-2-ylidene]pentanoate |
| SMILES | COC(=O)CCC/C=C1/SCC(NC(=O)c2ccccc2)/C1=N/Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23N5O7S/c1-35-21(29)10-6-5-9-20-22(19(14-36-20)24-23(30)15-7-3-2-4-8-15)26-25-16-11-17(27(31)32)13-18(12-16)28(33)34/h2-4,7-9,11-13,19,25H,5-6,10,14H2,1H3,(H,24,30)/b20-9+,26-22- |
| InChIKey | QBNKJYJQSGOVLQ-KDSDELDFSA-N |
| XLogP | 4.04 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|