About (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one
(2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one (PubChem CID 6370976) has the molecular formula C17H16OS2
and a molecular weight of 300.45 g/mol. Its IUPAC name is (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one.
Molecular Properties
| Compound Name | (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one |
| PubChem CID | 6370976 |
| Molecular Formula | C17H16OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one |
| SMILES | CC1C/C(=C/c2ccsc2)C(=O)/C(=C/c2ccsc2)C1 |
| InChI | InChI=1S/C17H16OS2/c1-12-6-15(8-13-2-4-19-10-13)17(18)16(7-12)9-14-3-5-20-11-14/h2-5,8-12H,6-7H2,1H3/b15-8-,16-9+ |
| InChIKey | AEJUOGPJFWDBOL-IZKYPSLPSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one?
The IUPAC name of (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one (CID 6370976) is (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one.
What is the SMILES notation for (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one?
The canonical SMILES for (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one is CC1C/C(=C/c2ccsc2)C(=O)/C(=C/c2ccsc2)C1.
What is the InChIKey of (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one?
The InChIKey is AEJUOGPJFWDBOL-IZKYPSLPSA-N. The full InChI is InChI=1S/C17H16OS2/c1-12-6-15(8-13-2-4-19-10-13)17(18)16(7-12)9-14-3-5-20-11-14/h2-5,8-12H,6-7H2,1H3/b15-8-,16-9+.
What are the key properties of (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one?
(2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one has a molecular weight of 300.45 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,6E)-4-methyl-2,6-bis(thiophen-3-ylmethylidene)cyclohexan-1-one is sourced from PubChem (CID 6370976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).