C16H13BrF2O — CID 63710116
4-[bromo-(2,4-difluorophenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 63710116) has the molecular formula C16H13BrF2O and a molecular weight of 339.18 g/mol. Its IUPAC name is 4-[bromo-(2,4-difluorophenyl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[bromo-(2,4-difluorophenyl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 63710116 |
| Molecular Formula | C16H13BrF2O |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 4-[bromo-(2,4-difluorophenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Fc1ccc(C(Br)C2CCOc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C16H13BrF2O/c17-16(13-6-5-10(18)9-14(13)19)12-7-8-20-15-4-2-1-3-11(12)15/h1-6,9,12,16H,7-8H2 |
| InChIKey | JQGRUCJBRCBPLS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|