About N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide
N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 63710571) has the molecular formula C11H16F6N2O
and a molecular weight of 306.25 g/mol. Its IUPAC name is N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| PubChem CID | 63710571 |
| Molecular Formula | C11H16F6N2O |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H16F6N2O/c1-2-5-19(7-10(12,13)14)8(20)9(11(15,16)17)3-4-18-6-9/h18H,2-7H2,1H3 |
| InChIKey | WJEJDQCJEFQOTD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
The IUPAC name of N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (CID 63710571) is N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
What is the SMILES notation for N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
The canonical SMILES for N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide is CCCN(CC(F)(F)F)C(=O)C1(C(F)(F)F)CCNC1.
What is the InChIKey of N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
The InChIKey is WJEJDQCJEFQOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F6N2O/c1-2-5-19(7-10(12,13)14)8(20)9(11(15,16)17)3-4-18-6-9/h18H,2-7H2,1H3.
What are the key properties of N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide?
N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide has a molecular weight of 306.25 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 63710571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).