C15H22FN3O — CID 63711867
5-fluoro-2-[[methyl(oxan-3-ylmethyl)amino]methyl]benzenecarboximidamide (PubChem CID 63711867) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-fluoro-2-[[methyl(oxan-3-ylmethyl)amino]methyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-2-[[methyl(oxan-3-ylmethyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 63711867 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 5-fluoro-2-[[methyl(oxan-3-ylmethyl)amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1CN(C)CC1CCCOC1 |
| InChI | InChI=1S/C15H22FN3O/c1-19(8-11-3-2-6-20-10-11)9-12-4-5-13(16)7-14(12)15(17)18/h4-5,7,11H,2-3,6,8-10H2,1H3,(H3,17,18) |
| InChIKey | GXTYWPKFHNTEFS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|