About 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile
4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile (PubChem CID 6371206) has the molecular formula C17H9F3N2O
and a molecular weight of 314.27 g/mol. Its IUPAC name is 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile |
| PubChem CID | 6371206 |
| Molecular Formula | C17H9F3N2O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile |
| SMILES | N#C/C(=C(\Oc1ccc(C#N)cc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H9F3N2O/c18-17(19,20)16(15(11-22)13-4-2-1-3-5-13)23-14-8-6-12(10-21)7-9-14/h1-9H/b16-15+ |
| InChIKey | GGUQMHMUPHNHMQ-FOCLMDBBSA-N |
| XLogP | 4.43 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile?
The IUPAC name of 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile (CID 6371206) is 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile.
What is the SMILES notation for 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile?
The canonical SMILES for 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile is N#C/C(=C(\Oc1ccc(C#N)cc1)C(F)(F)F)c1ccccc1.
What is the InChIKey of 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile?
The InChIKey is GGUQMHMUPHNHMQ-FOCLMDBBSA-N. The full InChI is InChI=1S/C17H9F3N2O/c18-17(19,20)16(15(11-22)13-4-2-1-3-5-13)23-14-8-6-12(10-21)7-9-14/h1-9H/b16-15+.
What are the key properties of 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile?
4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile has a molecular weight of 314.27 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-1-cyano-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]oxybenzonitrile is sourced from PubChem (CID 6371206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).