C14H18N2O4 — CID 63712229
4-[methyl(oxan-3-ylmethyl)amino]-3-nitrobenzaldehyde (PubChem CID 63712229) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[methyl(oxan-3-ylmethyl)amino]-3-nitrobenzaldehyde.
| Compound Name | 4-[methyl(oxan-3-ylmethyl)amino]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 63712229 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[methyl(oxan-3-ylmethyl)amino]-3-nitrobenzaldehyde |
| SMILES | CN(CC1CCCOC1)c1ccc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O4/c1-15(8-12-3-2-6-20-10-12)13-5-4-11(9-17)7-14(13)16(18)19/h4-5,7,9,12H,2-3,6,8,10H2,1H3 |
| InChIKey | IKZITKKMAXSCGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|