C12H19N3O5S — CID 63712750
2-[4-[methyl(oxan-4-ylmethyl)sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 63712750) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[4-[methyl(oxan-4-ylmethyl)sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[methyl(oxan-4-ylmethyl)sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 63712750 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[4-[methyl(oxan-4-ylmethyl)sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | CN(CC1CCOCC1)S(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C12H19N3O5S/c1-14(7-10-2-4-20-5-3-10)21(18,19)11-6-13-15(8-11)9-12(16)17/h6,8,10H,2-5,7,9H2,1H3,(H,16,17) |
| InChIKey | DMJFVMLWDHQPSG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |